About (2S)-N-(2,2,2-trifluoroethyl)aziridine-2-carboxamide
(2S)-N-(2,2,2-trifluoroethyl)aziridine-2-carboxamide (PubChem CID 97184752) has the molecular formula C5H7F3N2O
and a molecular weight of 168.12 g/mol. Its IUPAC name is (2S)-N-(2,2,2-trifluoroethyl)aziridine-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-N-(2,2,2-trifluoroethyl)aziridine-2-carboxamide |
| PubChem CID | 97184752 |
| Molecular Formula | C5H7F3N2O |
| Molecular Weight | 168.12 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | (2S)-N-(2,2,2-trifluoroethyl)aziridine-2-carboxamide |
| SMILES | O=C(NCC(F)(F)F)[C@@H]1CN1 |
| InChI | InChI=1S/C5H7F3N2O/c6-5(7,8)2-10-4(11)3-1-9-3/h3,9H,1-2H2,(H,10,11)/t3-/m0/s1 |
| InChIKey | VGIRYFKSPHLRSW-VKHMYHEASA-N |
| XLogP | -0.36 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.12 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N-(2,2,2-trifluoroethyl)aziridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-(2,2,2-trifluoroethyl)aziridine-2-carboxamide?
The IUPAC name of (2S)-N-(2,2,2-trifluoroethyl)aziridine-2-carboxamide (CID 97184752) is (2S)-N-(2,2,2-trifluoroethyl)aziridine-2-carboxamide.
What is the SMILES notation for (2S)-N-(2,2,2-trifluoroethyl)aziridine-2-carboxamide?
The canonical SMILES for (2S)-N-(2,2,2-trifluoroethyl)aziridine-2-carboxamide is O=C(NCC(F)(F)F)[C@@H]1CN1.
What is the InChIKey of (2S)-N-(2,2,2-trifluoroethyl)aziridine-2-carboxamide?
The InChIKey is VGIRYFKSPHLRSW-VKHMYHEASA-N. The full InChI is InChI=1S/C5H7F3N2O/c6-5(7,8)2-10-4(11)3-1-9-3/h3,9H,1-2H2,(H,10,11)/t3-/m0/s1.
What are the key properties of (2S)-N-(2,2,2-trifluoroethyl)aziridine-2-carboxamide?
(2S)-N-(2,2,2-trifluoroethyl)aziridine-2-carboxamide has a molecular weight of 168.12 g/mol, XLogP of -0.36, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-(2,2,2-trifluoroethyl)aziridine-2-carboxamide is sourced from PubChem (CID 97184752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).