C9H15F3N2O — CID 24704463
6-methyl-N-(2,2,2-trifluoroethyl)piperidine-2-carboxamide (PubChem CID 24704463) has the molecular formula C9H15F3N2O and a molecular weight of 224.23 g/mol. Its IUPAC name is 6-methyl-N-(2,2,2-trifluoroethyl)piperidine-2-carboxamide.
| Compound Name | 6-methyl-N-(2,2,2-trifluoroethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 24704463 |
| Molecular Formula | C9H15F3N2O |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 6-methyl-N-(2,2,2-trifluoroethyl)piperidine-2-carboxamide |
| SMILES | CC1CCCC(C(=O)NCC(F)(F)F)N1 |
| InChI | InChI=1S/C9H15F3N2O/c1-6-3-2-4-7(14-6)8(15)13-5-9(10,11)12/h6-7,14H,2-5H2,1H3,(H,13,15) |
| InChIKey | HKNZCBPDBBAUIN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |