C11H18ClF3N2O — CID 119290994
N-(2,2,2-trifluoroethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119290994) has the molecular formula C11H18ClF3N2O and a molecular weight of 286.73 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-(2,2,2-trifluoroethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119290994 |
| Molecular Formula | C11H18ClF3N2O |
| Molecular Weight | 286.73 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N-(2,2,2-trifluoroethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCC(F)(F)F)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C11H17F3N2O.ClH/c12-11(13,14)6-15-10(17)9-5-7-3-1-2-4-8(7)16-9;/h7-9,16H,1-6H2,(H,15,17);1H |
| InChIKey | AZARKHLGMXNBDM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.73 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |