C15H27N3O2 — CID 43515209
N-[2-(tert-butylamino)-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 43515209) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 43515209 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)CNC(=O)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C15H27N3O2/c1-15(2,3)18-13(19)9-16-14(20)12-8-10-6-4-5-7-11(10)17-12/h10-12,17H,4-9H2,1-3H3,(H,16,20)(H,18,19) |
| InChIKey | AMGPCHNNUDTONI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |