C16H31ClN2O2 — CID 119328909
N-(2-hydroxy-4,4-dimethylpentyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119328909) has the molecular formula C16H31ClN2O2 and a molecular weight of 318.89 g/mol. Its IUPAC name is N-(2-hydroxy-4,4-dimethylpentyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-(2-hydroxy-4,4-dimethylpentyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119328909 |
| Molecular Formula | C16H31ClN2O2 |
| Molecular Weight | 318.89 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | N-(2-hydroxy-4,4-dimethylpentyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | CC(C)(C)CC(O)CNC(=O)C1CC2CCCCC2N1.Cl |
| InChI | InChI=1S/C16H30N2O2.ClH/c1-16(2,3)9-12(19)10-17-15(20)14-8-11-6-4-5-7-13(11)18-14;/h11-14,18-19H,4-10H2,1-3H3,(H,17,20);1H |
| InChIKey | IDKPWRNZEDFDRY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.89 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |