C17H32N2O2 — CID 107152829
N-(2-hydroxy-4,4-dimethylpentyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carboxamide (PubChem CID 107152829) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is N-(2-hydroxy-4,4-dimethylpentyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carboxamide.
| Compound Name | N-(2-hydroxy-4,4-dimethylpentyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carboxamide |
|---|---|
| PubChem CID | 107152829 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | N-(2-hydroxy-4,4-dimethylpentyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carboxamide |
| SMILES | CC(C)(C)CC(O)CNC(=O)C1CCC2CCCCC2N1 |
| InChI | InChI=1S/C17H32N2O2/c1-17(2,3)10-13(20)11-18-16(21)15-9-8-12-6-4-5-7-14(12)19-15/h12-15,19-20H,4-11H2,1-3H3,(H,18,21) |
| InChIKey | FCSUSXZRDXFPOI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |