C16H31N3O — CID 66470587
N-[2-(dimethylamino)-2-methylpropyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carboxamide (PubChem CID 66470587) has the molecular formula C16H31N3O and a molecular weight of 281.44 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-methylpropyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carboxamide.
| Compound Name | N-[2-(dimethylamino)-2-methylpropyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carboxamide |
|---|---|
| PubChem CID | 66470587 |
| Molecular Formula | C16H31N3O |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | N-[2-(dimethylamino)-2-methylpropyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carboxamide |
| SMILES | CN(C)C(C)(C)CNC(=O)C1CCC2CCCCC2N1 |
| InChI | InChI=1S/C16H31N3O/c1-16(2,19(3)4)11-17-15(20)14-10-9-12-7-5-6-8-13(12)18-14/h12-14,18H,5-11H2,1-4H3,(H,17,20) |
| InChIKey | GRFSGGITELKMGK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |