C15H26N2O3 — CID 66471212
3-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carbonylamino)-3-methylbutanoic acid (PubChem CID 66471212) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 3-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carbonylamino)-3-methylbutanoic acid.
| Compound Name | 3-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carbonylamino)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 66471212 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 3-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-2-carbonylamino)-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)NC(=O)C1CCC2CCCCC2N1 |
| InChI | InChI=1S/C15H26N2O3/c1-15(2,9-13(18)19)17-14(20)12-8-7-10-5-3-4-6-11(10)16-12/h10-12,16H,3-9H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | ITCTWDNFQFRJIC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |