C12H17F4O5S- — CID 58870858
3-cyclohexylpropyl 2,3,3,3-tetrafluoro-2-oxidoperoxysulfanylpropanoate (PubChem CID 58870858) has the molecular formula C12H17F4O5S- and a molecular weight of 349.32 g/mol. Its IUPAC name is 3-cyclohexylpropyl 2,3,3,3-tetrafluoro-2-oxidoperoxysulfanylpropanoate.
| Compound Name | 3-cyclohexylpropyl 2,3,3,3-tetrafluoro-2-oxidoperoxysulfanylpropanoate |
|---|---|
| PubChem CID | 58870858 |
| Molecular Formula | C12H17F4O5S- |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 3-cyclohexylpropyl 2,3,3,3-tetrafluoro-2-oxidoperoxysulfanylpropanoate |
| SMILES | O=C(OCCCC1CCCCC1)C(F)(SOO[O-])C(F)(F)F |
| InChI | InChI=1S/C12H18F4O5S/c13-11(12(14,15)16,22-21-20-18)10(17)19-8-4-7-9-5-2-1-3-6-9/h9,18H,1-8H2/p-1 |
| InChIKey | PFRKTVUVMDPHEL-UHFFFAOYSA-M |
| XLogP | 2.99 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|