C21H31O7S- — CID 23393558
2-[2-(4-cyclohexylbutoxy)ethoxy]ethyl 4-oxidoperoxysulfanylbenzoate (PubChem CID 23393558) has the molecular formula C21H31O7S- and a molecular weight of 427.54 g/mol. Its IUPAC name is 2-[2-(4-cyclohexylbutoxy)ethoxy]ethyl 4-oxidoperoxysulfanylbenzoate.
| Compound Name | 2-[2-(4-cyclohexylbutoxy)ethoxy]ethyl 4-oxidoperoxysulfanylbenzoate |
|---|---|
| PubChem CID | 23393558 |
| Molecular Formula | C21H31O7S- |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 2-[2-(4-cyclohexylbutoxy)ethoxy]ethyl 4-oxidoperoxysulfanylbenzoate |
| SMILES | O=C(OCCOCCOCCCCC1CCCCC1)c1ccc(SOO[O-])cc1 |
| InChI | InChI=1S/C21H32O7S/c22-21(19-9-11-20(12-10-19)29-28-27-23)26-17-16-25-15-14-24-13-5-4-8-18-6-2-1-3-7-18/h9-12,18,23H,1-8,13-17H2/p-1 |
| InChIKey | ONUPAORBZFIQQN-UHFFFAOYSA-M |
| XLogP | 3.86 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|