About 2-cyclohexylethyl 2-chloro-4-oxidoperoxysulfanylbenzoate
2-cyclohexylethyl 2-chloro-4-oxidoperoxysulfanylbenzoate (PubChem CID 58800743) has the molecular formula C15H18ClO5S-
and a molecular weight of 345.82 g/mol. Its IUPAC name is 2-cyclohexylethyl 2-chloro-4-oxidoperoxysulfanylbenzoate.
Molecular Properties
| Compound Name | 2-cyclohexylethyl 2-chloro-4-oxidoperoxysulfanylbenzoate |
| PubChem CID | 58800743 |
| Molecular Formula | C15H18ClO5S- |
| Molecular Weight | 345.82 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 2-cyclohexylethyl 2-chloro-4-oxidoperoxysulfanylbenzoate |
| SMILES | O=C(OCCC1CCCCC1)c1ccc(SOO[O-])cc1Cl |
| InChI | InChI=1S/C15H19ClO5S/c16-14-10-12(22-21-20-18)6-7-13(14)15(17)19-9-8-11-4-2-1-3-5-11/h6-7,10-11,18H,1-5,8-9H2/p-1 |
| InChIKey | LGCFHNQGLMYWHS-UHFFFAOYSA-M |
| XLogP | 3.70 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.82 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexylethyl 2-chloro-4-oxidoperoxysulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylethyl 2-chloro-4-oxidoperoxysulfanylbenzoate?
The IUPAC name of 2-cyclohexylethyl 2-chloro-4-oxidoperoxysulfanylbenzoate (CID 58800743) is 2-cyclohexylethyl 2-chloro-4-oxidoperoxysulfanylbenzoate.
What is the SMILES notation for 2-cyclohexylethyl 2-chloro-4-oxidoperoxysulfanylbenzoate?
The canonical SMILES for 2-cyclohexylethyl 2-chloro-4-oxidoperoxysulfanylbenzoate is O=C(OCCC1CCCCC1)c1ccc(SOO[O-])cc1Cl.
What is the InChIKey of 2-cyclohexylethyl 2-chloro-4-oxidoperoxysulfanylbenzoate?
The InChIKey is LGCFHNQGLMYWHS-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H19ClO5S/c16-14-10-12(22-21-20-18)6-7-13(14)15(17)19-9-8-11-4-2-1-3-5-11/h6-7,10-11,18H,1-5,8-9H2/p-1.
What are the key properties of 2-cyclohexylethyl 2-chloro-4-oxidoperoxysulfanylbenzoate?
2-cyclohexylethyl 2-chloro-4-oxidoperoxysulfanylbenzoate has a molecular weight of 345.82 g/mol, XLogP of 3.70, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylethyl 2-chloro-4-oxidoperoxysulfanylbenzoate is sourced from PubChem (CID 58800743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).