C15H17N2O9S- — CID 23393580
2-cyclohexylethyl 3,5-dinitro-4-oxidoperoxysulfanylbenzoate (PubChem CID 23393580) has the molecular formula C15H17N2O9S- and a molecular weight of 401.37 g/mol. Its IUPAC name is 2-cyclohexylethyl 3,5-dinitro-4-oxidoperoxysulfanylbenzoate.
| Compound Name | 2-cyclohexylethyl 3,5-dinitro-4-oxidoperoxysulfanylbenzoate |
|---|---|
| PubChem CID | 23393580 |
| Molecular Formula | C15H17N2O9S- |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 2-cyclohexylethyl 3,5-dinitro-4-oxidoperoxysulfanylbenzoate |
| SMILES | O=C(OCCC1CCCCC1)c1cc([N+](=O)[O-])c(SOO[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H18N2O9S/c18-15(24-7-6-10-4-2-1-3-5-10)11-8-12(16(19)20)14(27-26-25-23)13(9-11)17(21)22/h8-10,23H,1-7H2/p-1 |
| InChIKey | FKSBNWDNCSNFDZ-UHFFFAOYSA-M |
| XLogP | 2.86 |
| TPSA | 154.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|