C18H28N2O3 — CID 146987080
2-(2-aminoethoxy)ethyl 3-amino-4-(cyclohexylmethyl)benzoate (PubChem CID 146987080) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is 2-(2-aminoethoxy)ethyl 3-amino-4-(cyclohexylmethyl)benzoate.
| Compound Name | 2-(2-aminoethoxy)ethyl 3-amino-4-(cyclohexylmethyl)benzoate |
|---|---|
| PubChem CID | 146987080 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 2-(2-aminoethoxy)ethyl 3-amino-4-(cyclohexylmethyl)benzoate |
| SMILES | NCCOCCOC(=O)c1ccc(CC2CCCCC2)c(N)c1 |
| InChI | InChI=1S/C18H28N2O3/c19-8-9-22-10-11-23-18(21)16-7-6-15(17(20)13-16)12-14-4-2-1-3-5-14/h6-7,13-14H,1-5,8-12,19-20H2 |
| InChIKey | APLUAJIKTNNCNZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|