C42H65N3O8 — CID 161183249
2-(2-aminoethoxy)ethyl 3-amino-4-(cyclohexylmethyl)benzoate;2-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]ethyl 3-amino-4-(cyclohexylmethyl)benzoate (PubChem CID 161183249) has the molecular formula C42H65N3O8 and a molecular weight of 739.99 g/mol. Its IUPAC name is 2-(2-aminoethoxy)ethyl 3-amino-4-(cyclohexylmethyl)benzoate;2-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]ethyl 3-amino-4-(cyclohexylmethyl)benzoate.
| Compound Name | 2-(2-aminoethoxy)ethyl 3-amino-4-(cyclohexylmethyl)benzoate;2-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]ethyl 3-amino-4-(cyclohexylmethyl)benzoate |
|---|---|
| PubChem CID | 161183249 |
| Molecular Formula | C42H65N3O8 |
| Molecular Weight | 739.99 g/mol |
| Exact Mass | 739.48 |
| IUPAC Name | 2-(2-aminoethoxy)ethyl 3-amino-4-(cyclohexylmethyl)benzoate;2-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]ethyl 3-amino-4-(cyclohexylmethyl)benzoate |
| SMILES | CC(C)(C)OC(=O)CCCOCCOC(=O)c1ccc(CC2CCCCC2)c(N)c1.NCCOCCOC(=O)c1ccc(CC2CCCCC2)c(N)c1 |
| InChI | InChI=1S/C24H37NO5.C18H28N2O3/c1-24(2,3)30-22(26)10-7-13-28-14-15-29-23(27)20-12-11-19(21(25)17-20)16-18-8-5-4-6-9-18;19-8-9-22-10-11-23-18(21)16-7-6-15(17(20)13-16)12-14-4-2-1-3-5-14/h11-12,17-18H,4-10,13-16,25H2,1-3H3;6-7,13-14H,1-5,8-12,19-20H2 |
| InChIKey | USTFMFLQZOJCNI-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 175.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.99 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|