About 3-cyclohexylpropyl 2-(1-methylpiperidin-1-ium-1-yl)acetate
3-cyclohexylpropyl 2-(1-methylpiperidin-1-ium-1-yl)acetate (PubChem CID 3122278) has the molecular formula C17H32NO2+
and a molecular weight of 282.45 g/mol. Its IUPAC name is 3-cyclohexylpropyl 2-(1-methylpiperidin-1-ium-1-yl)acetate.
Molecular Properties
| Compound Name | 3-cyclohexylpropyl 2-(1-methylpiperidin-1-ium-1-yl)acetate |
| PubChem CID | 3122278 |
| Molecular Formula | C17H32NO2+ |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | 3-cyclohexylpropyl 2-(1-methylpiperidin-1-ium-1-yl)acetate |
| SMILES | C[N+]1(CC(=O)OCCCC2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C17H32NO2/c1-18(12-6-3-7-13-18)15-17(19)20-14-8-11-16-9-4-2-5-10-16/h16H,2-15H2,1H3/q+1 |
| InChIKey | OTNXNCKZCALLJH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexylpropyl 2-(1-methylpiperidin-1-ium-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylpropyl 2-(1-methylpiperidin-1-ium-1-yl)acetate?
The IUPAC name of 3-cyclohexylpropyl 2-(1-methylpiperidin-1-ium-1-yl)acetate (CID 3122278) is 3-cyclohexylpropyl 2-(1-methylpiperidin-1-ium-1-yl)acetate.
What is the SMILES notation for 3-cyclohexylpropyl 2-(1-methylpiperidin-1-ium-1-yl)acetate?
The canonical SMILES for 3-cyclohexylpropyl 2-(1-methylpiperidin-1-ium-1-yl)acetate is C[N+]1(CC(=O)OCCCC2CCCCC2)CCCCC1.
What is the InChIKey of 3-cyclohexylpropyl 2-(1-methylpiperidin-1-ium-1-yl)acetate?
The InChIKey is OTNXNCKZCALLJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32NO2/c1-18(12-6-3-7-13-18)15-17(19)20-14-8-11-16-9-4-2-5-10-16/h16H,2-15H2,1H3/q+1.
What are the key properties of 3-cyclohexylpropyl 2-(1-methylpiperidin-1-ium-1-yl)acetate?
3-cyclohexylpropyl 2-(1-methylpiperidin-1-ium-1-yl)acetate has a molecular weight of 282.45 g/mol, XLogP of 3.52, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylpropyl 2-(1-methylpiperidin-1-ium-1-yl)acetate is sourced from PubChem (CID 3122278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).