About 5-[3-(1-methylazepan-1-ium-1-yl)propanoyloxy]pentyl 3-(1-methylazepan-1-ium-1-yl)propanoate diiodide
5-[3-(1-methylazepan-1-ium-1-yl)propanoyloxy]pentyl 3-(1-methylazepan-1-ium-1-yl)propanoate diiodide (PubChem CID 10032608) has the molecular formula C25H48I2N2O4
and a molecular weight of 694.48 g/mol. Its IUPAC name is 5-[3-(1-methylazepan-1-ium-1-yl)propanoyloxy]pentyl 3-(1-methylazepan-1-ium-1-yl)propanoate diiodide.
Molecular Properties
| Compound Name | 5-[3-(1-methylazepan-1-ium-1-yl)propanoyloxy]pentyl 3-(1-methylazepan-1-ium-1-yl)propanoate diiodide |
| PubChem CID | 10032608 |
| Molecular Formula | C25H48I2N2O4 |
| Molecular Weight | 694.48 g/mol |
| Exact Mass | 694.17 |
| IUPAC Name | 5-[3-(1-methylazepan-1-ium-1-yl)propanoyloxy]pentyl 3-(1-methylazepan-1-ium-1-yl)propanoate diiodide |
| SMILES | C[N+]1(CCC(=O)OCCCCCOC(=O)CC[N+]2(C)CCCCCC2)CCCCCC1.[I-].[I-] |
| InChI | InChI=1S/C25H48N2O4.2HI/c1-26(16-8-3-4-9-17-26)20-14-24(28)30-22-12-7-13-23-31-25(29)15-21-27(2)18-10-5-6-11-19-27;;/h3-23H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | UMBMZMLEMHVTCH-UHFFFAOYSA-L |
| XLogP | -1.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 694.48 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-(1-methylazepan-1-ium-1-yl)propanoyloxy]pentyl 3-(1-methylazepan-1-ium-1-yl)propanoate diiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(1-methylazepan-1-ium-1-yl)propanoyloxy]pentyl 3-(1-methylazepan-1-ium-1-yl)propanoate diiodide?
The IUPAC name of 5-[3-(1-methylazepan-1-ium-1-yl)propanoyloxy]pentyl 3-(1-methylazepan-1-ium-1-yl)propanoate diiodide (CID 10032608) is 5-[3-(1-methylazepan-1-ium-1-yl)propanoyloxy]pentyl 3-(1-methylazepan-1-ium-1-yl)propanoate diiodide.
What is the SMILES notation for 5-[3-(1-methylazepan-1-ium-1-yl)propanoyloxy]pentyl 3-(1-methylazepan-1-ium-1-yl)propanoate diiodide?
The canonical SMILES for 5-[3-(1-methylazepan-1-ium-1-yl)propanoyloxy]pentyl 3-(1-methylazepan-1-ium-1-yl)propanoate diiodide is C[N+]1(CCC(=O)OCCCCCOC(=O)CC[N+]2(C)CCCCCC2)CCCCCC1.[I-].[I-].
What is the InChIKey of 5-[3-(1-methylazepan-1-ium-1-yl)propanoyloxy]pentyl 3-(1-methylazepan-1-ium-1-yl)propanoate diiodide?
The InChIKey is UMBMZMLEMHVTCH-UHFFFAOYSA-L. The full InChI is InChI=1S/C25H48N2O4.2HI/c1-26(16-8-3-4-9-17-26)20-14-24(28)30-22-12-7-13-23-31-25(29)15-21-27(2)18-10-5-6-11-19-27;;/h3-23H2,1-2H3;2*1H/q+2;;/p-2.
What are the key properties of 5-[3-(1-methylazepan-1-ium-1-yl)propanoyloxy]pentyl 3-(1-methylazepan-1-ium-1-yl)propanoate diiodide?
5-[3-(1-methylazepan-1-ium-1-yl)propanoyloxy]pentyl 3-(1-methylazepan-1-ium-1-yl)propanoate diiodide has a molecular weight of 694.48 g/mol, XLogP of -1.93, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(1-methylazepan-1-ium-1-yl)propanoyloxy]pentyl 3-(1-methylazepan-1-ium-1-yl)propanoate diiodide is sourced from PubChem (CID 10032608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).