C10H18Br2NO2+ — CID 162509346
2-(1-methylpiperidin-1-ium-1-yl)ethyl 2,2-dibromoacetate (PubChem CID 162509346) has the molecular formula C10H18Br2NO2+ and a molecular weight of 344.07 g/mol. Its IUPAC name is 2-(1-methylpiperidin-1-ium-1-yl)ethyl 2,2-dibromoacetate.
| Compound Name | 2-(1-methylpiperidin-1-ium-1-yl)ethyl 2,2-dibromoacetate |
|---|---|
| PubChem CID | 162509346 |
| Molecular Formula | C10H18Br2NO2+ |
| Molecular Weight | 344.07 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | 2-(1-methylpiperidin-1-ium-1-yl)ethyl 2,2-dibromoacetate |
| SMILES | C[N+]1(CCOC(=O)C(Br)Br)CCCCC1 |
| InChI | InChI=1S/C10H18Br2NO2/c1-13(5-3-2-4-6-13)7-8-15-10(14)9(11)12/h9H,2-8H2,1H3/q+1 |
| InChIKey | USSDHXQCJOSNDB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.07 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|