C18H36NO2+ — CID 3122286
3,7-dimethyloctyl 2-(1-methylpiperidin-1-ium-1-yl)acetate (PubChem CID 3122286) has the molecular formula C18H36NO2+ and a molecular weight of 298.49 g/mol. Its IUPAC name is 3,7-dimethyloctyl 2-(1-methylpiperidin-1-ium-1-yl)acetate.
| Compound Name | 3,7-dimethyloctyl 2-(1-methylpiperidin-1-ium-1-yl)acetate |
|---|---|
| PubChem CID | 3122286 |
| Molecular Formula | C18H36NO2+ |
| Molecular Weight | 298.49 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | 3,7-dimethyloctyl 2-(1-methylpiperidin-1-ium-1-yl)acetate |
| SMILES | CC(C)CCCC(C)CCOC(=O)C[N+]1(C)CCCCC1 |
| InChI | InChI=1S/C18H36NO2/c1-16(2)9-8-10-17(3)11-14-21-18(20)15-19(4)12-6-5-7-13-19/h16-17H,5-15H2,1-4H3/q+1 |
| InChIKey | FESWBDCXEBOLRE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|