C24H46O5 — CID 91714977
decyl 2-[2-(3,7-dimethyloctoxy)-2-oxoethoxy]acetate (PubChem CID 91714977) has the molecular formula C24H46O5 and a molecular weight of 414.63 g/mol. Its IUPAC name is decyl 2-[2-(3,7-dimethyloctoxy)-2-oxoethoxy]acetate.
| Compound Name | decyl 2-[2-(3,7-dimethyloctoxy)-2-oxoethoxy]acetate |
|---|---|
| PubChem CID | 91714977 |
| Molecular Formula | C24H46O5 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.33 |
| IUPAC Name | decyl 2-[2-(3,7-dimethyloctoxy)-2-oxoethoxy]acetate |
| SMILES | CCCCCCCCCCOC(=O)COCC(=O)OCCC(C)CCCC(C)C |
| InChI | InChI=1S/C24H46O5/c1-5-6-7-8-9-10-11-12-17-28-23(25)19-27-20-24(26)29-18-16-22(4)15-13-14-21(2)3/h21-22H,5-20H2,1-4H3 |
| InChIKey | ZJYYDBXWSFPAKM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|