About 7-methyloctyl 2-ethoxyacetate
7-methyloctyl 2-ethoxyacetate (PubChem CID 175943194) has the molecular formula C13H26O3
and a molecular weight of 230.35 g/mol. Its IUPAC name is 7-methyloctyl 2-ethoxyacetate.
Molecular Properties
| Compound Name | 7-methyloctyl 2-ethoxyacetate |
| PubChem CID | 175943194 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | 7-methyloctyl 2-ethoxyacetate |
| SMILES | CCOCC(=O)OCCCCCCC(C)C |
| InChI | InChI=1S/C13H26O3/c1-4-15-11-13(14)16-10-8-6-5-7-9-12(2)3/h12H,4-11H2,1-3H3 |
| InChIKey | PSRNPCJWHZKXCV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-methyloctyl 2-ethoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyloctyl 2-ethoxyacetate?
The IUPAC name of 7-methyloctyl 2-ethoxyacetate (CID 175943194) is 7-methyloctyl 2-ethoxyacetate.
What is the SMILES notation for 7-methyloctyl 2-ethoxyacetate?
The canonical SMILES for 7-methyloctyl 2-ethoxyacetate is CCOCC(=O)OCCCCCCC(C)C.
What is the InChIKey of 7-methyloctyl 2-ethoxyacetate?
The InChIKey is PSRNPCJWHZKXCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O3/c1-4-15-11-13(14)16-10-8-6-5-7-9-12(2)3/h12H,4-11H2,1-3H3.
What are the key properties of 7-methyloctyl 2-ethoxyacetate?
7-methyloctyl 2-ethoxyacetate has a molecular weight of 230.35 g/mol, XLogP of 3.17, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyloctyl 2-ethoxyacetate is sourced from PubChem (CID 175943194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).