C38H76NO4+ — CID 58133426
dimethyl-bis[2-(4,8,12-trimethyltridecanoyloxy)ethyl]azanium (PubChem CID 58133426) has the molecular formula C38H76NO4+ and a molecular weight of 611.03 g/mol. Its IUPAC name is dimethyl-bis[2-(4,8,12-trimethyltridecanoyloxy)ethyl]azanium.
| Compound Name | dimethyl-bis[2-(4,8,12-trimethyltridecanoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 58133426 |
| Molecular Formula | C38H76NO4+ |
| Molecular Weight | 611.03 g/mol |
| Exact Mass | 610.58 |
| IUPAC Name | dimethyl-bis[2-(4,8,12-trimethyltridecanoyloxy)ethyl]azanium |
| SMILES | CC(C)CCCC(C)CCCC(C)CCC(=O)OCC[N+](C)(C)CCOC(=O)CCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C38H76NO4/c1-31(2)15-11-17-33(5)19-13-21-35(7)23-25-37(40)42-29-27-39(9,10)28-30-43-38(41)26-24-36(8)22-14-20-34(6)18-12-16-32(3)4/h31-36H,11-30H2,1-10H3/q+1 |
| InChIKey | MVEQLDVPDFBQRL-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.03 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|