C17H32NO2+ — CID 7123650
[(1R,2R,4S)-2,4-dimethylcyclohexyl]methyl 2-(1-methylpiperidin-1-ium-1-yl)acetate (PubChem CID 7123650) has the molecular formula C17H32NO2+ and a molecular weight of 282.45 g/mol. Its IUPAC name is [(1R,2R,4S)-2,4-dimethylcyclohexyl]methyl 2-(1-methylpiperidin-1-ium-1-yl)acetate.
| Compound Name | [(1R,2R,4S)-2,4-dimethylcyclohexyl]methyl 2-(1-methylpiperidin-1-ium-1-yl)acetate |
|---|---|
| PubChem CID | 7123650 |
| Molecular Formula | C17H32NO2+ |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | [(1R,2R,4S)-2,4-dimethylcyclohexyl]methyl 2-(1-methylpiperidin-1-ium-1-yl)acetate |
| SMILES | C[C@H]1CC[C@@H](COC(=O)C[N+]2(C)CCCCC2)[C@H](C)C1 |
| InChI | InChI=1S/C17H32NO2/c1-14-7-8-16(15(2)11-14)13-20-17(19)12-18(3)9-5-4-6-10-18/h14-16H,4-13H2,1-3H3/q+1/t14-,15+,16-/m0/s1 |
| InChIKey | DPGGKDIWMDCOAY-XHSDSOJGSA-N |
| XLogP | 3.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|