About (2-methylcyclopropyl)methyl 2-(butanoylamino)acetate
(2-methylcyclopropyl)methyl 2-(butanoylamino)acetate (PubChem CID 71878693) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is (2-methylcyclopropyl)methyl 2-(butanoylamino)acetate.
Molecular Properties
| Compound Name | (2-methylcyclopropyl)methyl 2-(butanoylamino)acetate |
| PubChem CID | 71878693 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | (2-methylcyclopropyl)methyl 2-(butanoylamino)acetate |
| SMILES | CCCC(=O)NCC(=O)OCC1CC1C |
| InChI | InChI=1S/C11H19NO3/c1-3-4-10(13)12-6-11(14)15-7-9-5-8(9)2/h8-9H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | CVJUPSYHJGZBGP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methylcyclopropyl)methyl 2-(butanoylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylcyclopropyl)methyl 2-(butanoylamino)acetate?
The IUPAC name of (2-methylcyclopropyl)methyl 2-(butanoylamino)acetate (CID 71878693) is (2-methylcyclopropyl)methyl 2-(butanoylamino)acetate.
What is the SMILES notation for (2-methylcyclopropyl)methyl 2-(butanoylamino)acetate?
The canonical SMILES for (2-methylcyclopropyl)methyl 2-(butanoylamino)acetate is CCCC(=O)NCC(=O)OCC1CC1C.
What is the InChIKey of (2-methylcyclopropyl)methyl 2-(butanoylamino)acetate?
The InChIKey is CVJUPSYHJGZBGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3/c1-3-4-10(13)12-6-11(14)15-7-9-5-8(9)2/h8-9H,3-7H2,1-2H3,(H,12,13).
What are the key properties of (2-methylcyclopropyl)methyl 2-(butanoylamino)acetate?
(2-methylcyclopropyl)methyl 2-(butanoylamino)acetate has a molecular weight of 213.28 g/mol, XLogP of 1.10, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylcyclopropyl)methyl 2-(butanoylamino)acetate is sourced from PubChem (CID 71878693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).