About 2-methylsulfanylethyl 2-(butanoylamino)acetate
2-methylsulfanylethyl 2-(butanoylamino)acetate (PubChem CID 78862309) has the molecular formula C9H17NO3S
and a molecular weight of 219.31 g/mol. Its IUPAC name is 2-methylsulfanylethyl 2-(butanoylamino)acetate.
Molecular Properties
| Compound Name | 2-methylsulfanylethyl 2-(butanoylamino)acetate |
| PubChem CID | 78862309 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-methylsulfanylethyl 2-(butanoylamino)acetate |
| SMILES | CCCC(=O)NCC(=O)OCCSC |
| InChI | InChI=1S/C9H17NO3S/c1-3-4-8(11)10-7-9(12)13-5-6-14-2/h3-7H2,1-2H3,(H,10,11) |
| InChIKey | BGTSFIQNDCIISQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfanylethyl 2-(butanoylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanylethyl 2-(butanoylamino)acetate?
The IUPAC name of 2-methylsulfanylethyl 2-(butanoylamino)acetate (CID 78862309) is 2-methylsulfanylethyl 2-(butanoylamino)acetate.
What is the SMILES notation for 2-methylsulfanylethyl 2-(butanoylamino)acetate?
The canonical SMILES for 2-methylsulfanylethyl 2-(butanoylamino)acetate is CCCC(=O)NCC(=O)OCCSC.
What is the InChIKey of 2-methylsulfanylethyl 2-(butanoylamino)acetate?
The InChIKey is BGTSFIQNDCIISQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3S/c1-3-4-8(11)10-7-9(12)13-5-6-14-2/h3-7H2,1-2H3,(H,10,11).
What are the key properties of 2-methylsulfanylethyl 2-(butanoylamino)acetate?
2-methylsulfanylethyl 2-(butanoylamino)acetate has a molecular weight of 219.31 g/mol, XLogP of 0.81, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylethyl 2-(butanoylamino)acetate is sourced from PubChem (CID 78862309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).