C6H12N2O2S — CID 60668278
N-(2-amino-2-oxoethyl)-3-methylsulfanylpropanamide (PubChem CID 60668278) has the molecular formula C6H12N2O2S and a molecular weight of 176.24 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-methylsulfanylpropanamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 60668278 |
| Molecular Formula | C6H12N2O2S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-methylsulfanylpropanamide |
| SMILES | CSCCC(=O)NCC(N)=O |
| InChI | InChI=1S/C6H12N2O2S/c1-11-3-2-6(10)8-4-5(7)9/h2-4H2,1H3,(H2,7,9)(H,8,10) |
| InChIKey | ZUMSDPVWOOMLDX-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |