C10H18N2O2 — CID 60668206
N-(2-amino-2-oxoethyl)-3-cyclopentylpropanamide (PubChem CID 60668206) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-cyclopentylpropanamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-cyclopentylpropanamide |
|---|---|
| PubChem CID | 60668206 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-cyclopentylpropanamide |
| SMILES | NC(=O)CNC(=O)CCC1CCCC1 |
| InChI | InChI=1S/C10H18N2O2/c11-9(13)7-12-10(14)6-5-8-3-1-2-4-8/h8H,1-7H2,(H2,11,13)(H,12,14) |
| InChIKey | UVWNZZFSGGKECF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |