C12H19NO5S — CID 20643821
[3-[[2-(2-ethylsulfanylethoxy)-2-oxoethyl]amino]-3-oxopropyl] prop-2-enoate (PubChem CID 20643821) has the molecular formula C12H19NO5S and a molecular weight of 289.35 g/mol. Its IUPAC name is [3-[[2-(2-ethylsulfanylethoxy)-2-oxoethyl]amino]-3-oxopropyl] prop-2-enoate.
| Compound Name | [3-[[2-(2-ethylsulfanylethoxy)-2-oxoethyl]amino]-3-oxopropyl] prop-2-enoate |
|---|---|
| PubChem CID | 20643821 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | [3-[[2-(2-ethylsulfanylethoxy)-2-oxoethyl]amino]-3-oxopropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCC(=O)NCC(=O)OCCSCC |
| InChI | InChI=1S/C12H19NO5S/c1-3-11(15)17-6-5-10(14)13-9-12(16)18-7-8-19-4-2/h3H,1,4-9H2,2H3,(H,13,14) |
| InChIKey | DBIZQQCRZLRELE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|