C7H10N2O3S — CID 164846052
[3-(carbamothioylamino)-3-oxopropyl] prop-2-enoate (PubChem CID 164846052) has the molecular formula C7H10N2O3S and a molecular weight of 202.23 g/mol. Its IUPAC name is [3-(carbamothioylamino)-3-oxopropyl] prop-2-enoate.
| Compound Name | [3-(carbamothioylamino)-3-oxopropyl] prop-2-enoate |
|---|---|
| PubChem CID | 164846052 |
| Molecular Formula | C7H10N2O3S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | [3-(carbamothioylamino)-3-oxopropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCC(=O)NC(N)=S |
| InChI | InChI=1S/C7H10N2O3S/c1-2-6(11)12-4-3-5(10)9-7(8)13/h2H,1,3-4H2,(H3,8,9,10,13) |
| InChIKey | BCYGXVFUHMAJIC-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|