(2,4-dimethylcyclohexyl)methyl 2-(diethylamino)acetate

C15H29NO2 — CID 5112470

IUPAC(2,4-dimethylcyclohexyl)methyl 2-(diethylamino)acetate
SMILESCCN(CC)CC(=O)OCC1CCC(C)CC1C
InChIInChI=1S/C15H29NO2/c1-5-16(6-2)10-15(17)18-11-14-8-7-12(3)9-13(14)4/h12-14H,5-11H2,1-4H3
InChIKeyZCYCCCFXTSIPQS-UHFFFAOYSA-N
MW255.40 g/mol
LogP2.94
Rot. Bonds6

About (2,4-dimethylcyclohexyl)methyl 2-(diethylamino)acetate

(2,4-dimethylcyclohexyl)methyl 2-(diethylamino)acetate (PubChem CID 5112470) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is (2,4-dimethylcyclohexyl)methyl 2-(diethylamino)acetate.

Molecular Properties

Compound Name(2,4-dimethylcyclohexyl)methyl 2-(diethylamino)acetate
PubChem CID5112470
Molecular FormulaC15H29NO2
Molecular Weight255.40 g/mol
Exact Mass255.22
IUPAC Name(2,4-dimethylcyclohexyl)methyl 2-(diethylamino)acetate
SMILESCCN(CC)CC(=O)OCC1CCC(C)CC1C
InChIInChI=1S/C15H29NO2/c1-5-16(6-2)10-15(17)18-11-14-8-7-12(3)9-13(14)4/h12-14H,5-11H2,1-4H3
InChIKeyZCYCCCFXTSIPQS-UHFFFAOYSA-N
XLogP2.94
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.40
LogP ≤ 52.94
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze (2,4-dimethylcyclohexyl)methyl 2-(diethylamino)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4-dimethylcyclohexyl)methyl 2-(diethylamino)acetate?
The IUPAC name of (2,4-dimethylcyclohexyl)methyl 2-(diethylamino)acetate (CID 5112470) is (2,4-dimethylcyclohexyl)methyl 2-(diethylamino)acetate.
What is the SMILES notation for (2,4-dimethylcyclohexyl)methyl 2-(diethylamino)acetate?
The canonical SMILES for (2,4-dimethylcyclohexyl)methyl 2-(diethylamino)acetate is CCN(CC)CC(=O)OCC1CCC(C)CC1C.
What is the InChIKey of (2,4-dimethylcyclohexyl)methyl 2-(diethylamino)acetate?
The InChIKey is ZCYCCCFXTSIPQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO2/c1-5-16(6-2)10-15(17)18-11-14-8-7-12(3)9-13(14)4/h12-14H,5-11H2,1-4H3.
What are the key properties of (2,4-dimethylcyclohexyl)methyl 2-(diethylamino)acetate?
(2,4-dimethylcyclohexyl)methyl 2-(diethylamino)acetate has a molecular weight of 255.40 g/mol, XLogP of 2.94, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethylcyclohexyl)methyl 2-(diethylamino)acetate is sourced from PubChem (CID 5112470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).