C32H58N2O4+2 — CID 10485428
bis[(5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl)methyl] decanedioate (PubChem CID 10485428) has the molecular formula C32H58N2O4+2 and a molecular weight of 534.83 g/mol. Its IUPAC name is bis[(5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl)methyl] decanedioate.
| Compound Name | bis[(5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl)methyl] decanedioate |
|---|---|
| PubChem CID | 10485428 |
| Molecular Formula | C32H58N2O4+2 |
| Molecular Weight | 534.83 g/mol |
| Exact Mass | 534.44 |
| IUPAC Name | bis[(5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl)methyl] decanedioate |
| SMILES | C[N+]12CCCCC1C(COC(=O)CCCCCCCCC(=O)OCC1CCC[N+]3(C)CCCCC13)CCC2 |
| InChI | InChI=1S/C32H58N2O4/c1-33-21-11-9-17-29(33)27(15-13-23-33)25-37-31(35)19-7-5-3-4-6-8-20-32(36)38-26-28-16-14-24-34(2)22-12-10-18-30(28)34/h27-30H,3-26H2,1-2H3/q+2 |
| InChIKey | MWEJGTDGJFIKJL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.83 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|