C14H26NO3+ — CID 129449164
[(1R,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl (2S)-2-hydroxypropanoate (PubChem CID 129449164) has the molecular formula C14H26NO3+ and a molecular weight of 256.37 g/mol. Its IUPAC name is [(1R,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl (2S)-2-hydroxypropanoate.
| Compound Name | [(1R,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl (2S)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 129449164 |
| Molecular Formula | C14H26NO3+ |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | [(1R,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl (2S)-2-hydroxypropanoate |
| SMILES | C[C@H](O)C(=O)OC[C@@H]1CCC[N@@+]2(C)CCCC[C@@H]12 |
| InChI | InChI=1S/C14H26NO3/c1-11(16)14(17)18-10-12-6-5-9-15(2)8-4-3-7-13(12)15/h11-13,16H,3-10H2,1-2H3/q+1/t11-,12-,13-,15+/m0/s1 |
| InChIKey | ZSOWTAJVTXSYKL-PWNZVWSESA-N |
| XLogP | 1.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|