C15H26NO2+ — CID 124871600
[(1R,5S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2-methylprop-2-enoate (PubChem CID 124871600) has the molecular formula C15H26NO2+ and a molecular weight of 252.38 g/mol. Its IUPAC name is [(1R,5S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [(1R,5S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 124871600 |
| Molecular Formula | C15H26NO2+ |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | [(1R,5S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC[C@@H]1CCC[N@+]2(C)CCCC[C@H]12 |
| InChI | InChI=1S/C15H26NO2/c1-12(2)15(17)18-11-13-7-6-10-16(3)9-5-4-8-14(13)16/h13-14H,1,4-11H2,2-3H3/q+1/t13-,14+,16-/m0/s1 |
| InChIKey | NCRJWESTCYMYTR-LZWOXQAQSA-N |
| XLogP | 2.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|