C21H32NO2+ — CID 6953497
[(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2,4,5-trimethylbenzoate (PubChem CID 6953497) has the molecular formula C21H32NO2+ and a molecular weight of 330.49 g/mol. Its IUPAC name is [(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2,4,5-trimethylbenzoate.
| Compound Name | [(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2,4,5-trimethylbenzoate |
|---|---|
| PubChem CID | 6953497 |
| Molecular Formula | C21H32NO2+ |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | [(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2,4,5-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OC[C@@H]2CCC[N+]3(C)CCCC[C@H]23)cc1C |
| InChI | InChI=1S/C21H32NO2/c1-15-12-17(3)19(13-16(15)2)21(23)24-14-18-8-7-11-22(4)10-6-5-9-20(18)22/h12-13,18,20H,5-11,14H2,1-4H3/q+1/t18-,20+,22?/m0/s1 |
| InChIKey | HXRDLTAYKDJZSA-RUYIAYPLSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|