C19H26NO4+ — CID 124766486
[(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 1,3-benzodioxole-5-carboxylate (PubChem CID 124766486) has the molecular formula C19H26NO4+ and a molecular weight of 332.42 g/mol. Its IUPAC name is [(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 1,3-benzodioxole-5-carboxylate.
| Compound Name | [(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 124766486 |
| Molecular Formula | C19H26NO4+ |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | [(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 1,3-benzodioxole-5-carboxylate |
| SMILES | C[N@+]12CCCC[C@H]1[C@@H](COC(=O)c1ccc3c(c1)OCO3)CCC2 |
| InChI | InChI=1S/C19H26NO4/c1-20-9-3-2-6-16(20)15(5-4-10-20)12-22-19(21)14-7-8-17-18(11-14)24-13-23-17/h7-8,11,15-16H,2-6,9-10,12-13H2,1H3/q+1/t15-,16+,20-/m1/s1 |
| InChIKey | CZOWFUDDKUCISC-GQIGUUNPSA-N |
| XLogP | 2.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|