C21H26INO4 — CID 44660245
[(1S,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2-oxochromene-3-carboxylate iodide (PubChem CID 44660245) has the molecular formula C21H26INO4 and a molecular weight of 483.35 g/mol. Its IUPAC name is [(1S,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2-oxochromene-3-carboxylate iodide.
| Compound Name | [(1S,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2-oxochromene-3-carboxylate iodide |
|---|---|
| PubChem CID | 44660245 |
| Molecular Formula | C21H26INO4 |
| Molecular Weight | 483.35 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | [(1S,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2-oxochromene-3-carboxylate iodide |
| SMILES | C[N+]12CCCC[C@H]1[C@@H](COC(=O)c1cc3ccccc3oc1=O)CCC2.[I-] |
| InChI | InChI=1S/C21H26NO4.HI/c1-22-11-5-4-9-18(22)16(8-6-12-22)14-25-20(23)17-13-15-7-2-3-10-19(15)26-21(17)24;/h2-3,7,10,13,16,18H,4-6,8-9,11-12,14H2,1H3;1H/q+1;/p-1/t16-,18+,22?;/m1./s1 |
| InChIKey | UIUOCBUUEBPPOF-CEUBQAFJSA-M |
| XLogP | 0.36 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.35 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|