C18H25ClNO2+ — CID 6953526
[(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 4-chlorobenzoate (PubChem CID 6953526) has the molecular formula C18H25ClNO2+ and a molecular weight of 322.86 g/mol. Its IUPAC name is [(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 4-chlorobenzoate.
| Compound Name | [(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 4-chlorobenzoate |
|---|---|
| PubChem CID | 6953526 |
| Molecular Formula | C18H25ClNO2+ |
| Molecular Weight | 322.86 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | [(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 4-chlorobenzoate |
| SMILES | C[N+]12CCCC[C@@H]1[C@H](COC(=O)c1ccc(Cl)cc1)CCC2 |
| InChI | InChI=1S/C18H25ClNO2/c1-20-11-3-2-6-17(20)15(5-4-12-20)13-22-18(21)14-7-9-16(19)10-8-14/h7-10,15,17H,2-6,11-13H2,1H3/q+1/t15-,17+,20?/m0/s1 |
| InChIKey | UHLGCXYOJPRRIZ-DAPIJDQBSA-N |
| XLogP | 3.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.86 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|