C19H26Cl2NO3+ — CID 6985663
[(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2-(2,4-dichlorophenoxy)acetate (PubChem CID 6985663) has the molecular formula C19H26Cl2NO3+ and a molecular weight of 387.33 g/mol. Its IUPAC name is [(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 6985663 |
| Molecular Formula | C19H26Cl2NO3+ |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | [(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2-(2,4-dichlorophenoxy)acetate |
| SMILES | C[N+]12CCCC[C@@H]1[C@H](COC(=O)COc1ccc(Cl)cc1Cl)CCC2 |
| InChI | InChI=1S/C19H26Cl2NO3/c1-22-9-3-2-6-17(22)14(5-4-10-22)12-25-19(23)13-24-18-8-7-15(20)11-16(18)21/h7-8,11,14,17H,2-6,9-10,12-13H2,1H3/q+1/t14-,17+,22?/m0/s1 |
| InChIKey | AKHPLUPJRABLGT-CYEUYNBRSA-N |
| XLogP | 4.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|