C25H32NO2+ — CID 7078464
[(1R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2,2-diphenylacetate (PubChem CID 7078464) has the molecular formula C25H32NO2+ and a molecular weight of 378.54 g/mol. Its IUPAC name is [(1R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2,2-diphenylacetate.
| Compound Name | [(1R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2,2-diphenylacetate |
|---|---|
| PubChem CID | 7078464 |
| Molecular Formula | C25H32NO2+ |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | [(1R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2,2-diphenylacetate |
| SMILES | C[N+]12CCCC[C@H]1[C@H](COC(=O)C(c1ccccc1)c1ccccc1)CCC2 |
| InChI | InChI=1S/C25H32NO2/c1-26-17-9-8-16-23(26)22(15-10-18-26)19-28-25(27)24(20-11-4-2-5-12-20)21-13-6-3-7-14-21/h2-7,11-14,22-24H,8-10,15-19H2,1H3/q+1/t22-,23-,26?/m0/s1 |
| InChIKey | NFYRNAJXDJGGCJ-XAWUTYGVSA-N |
| XLogP | 4.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|