C20H30INO4 — CID 52993524
[(1R)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2,4-dimethoxybenzoate iodide (PubChem CID 52993524) has the molecular formula C20H30INO4 and a molecular weight of 475.37 g/mol. Its IUPAC name is [(1R)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2,4-dimethoxybenzoate iodide.
| Compound Name | [(1R)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2,4-dimethoxybenzoate iodide |
|---|---|
| PubChem CID | 52993524 |
| Molecular Formula | C20H30INO4 |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | [(1R)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 2,4-dimethoxybenzoate iodide |
| SMILES | COc1ccc(C(=O)OC[C@@H]2CCC[N+]3(C)CCCCC23)c(OC)c1.[I-] |
| InChI | InChI=1S/C20H30NO4.HI/c1-21-11-5-4-8-18(21)15(7-6-12-21)14-25-20(22)17-10-9-16(23-2)13-19(17)24-3;/h9-10,13,15,18H,4-8,11-12,14H2,1-3H3;1H/q+1;/p-1/t15-,18?,21?;/m0./s1 |
| InChIKey | OKFNBZAGQNWKJP-QLUJRRMDSA-M |
| XLogP | 0.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|