C21H32NO4+ — CID 1097027
2-[(1S,5S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]ethyl 3,4-dimethoxybenzoate (PubChem CID 1097027) has the molecular formula C21H32NO4+ and a molecular weight of 362.49 g/mol. Its IUPAC name is 2-[(1S,5S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]ethyl 3,4-dimethoxybenzoate.
| Compound Name | 2-[(1S,5S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]ethyl 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 1097027 |
| Molecular Formula | C21H32NO4+ |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | 2-[(1S,5S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]ethyl 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC[C@@H]2CCC[N@+]3(C)CCCC[C@H]23)cc1OC |
| InChI | InChI=1S/C21H32NO4/c1-22-12-5-4-8-18(22)16(7-6-13-22)11-14-26-21(23)17-9-10-19(24-2)20(15-17)25-3/h9-10,15-16,18H,4-8,11-14H2,1-3H3/q+1/t16-,18+,22-/m0/s1 |
| InChIKey | SGWSKHBQJXLTAT-CECAUBDESA-N |
| XLogP | 3.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|