C21H32NO3+ — CID 3525438
2-(5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl)ethyl 4-ethoxybenzoate (PubChem CID 3525438) has the molecular formula C21H32NO3+ and a molecular weight of 346.49 g/mol. Its IUPAC name is 2-(5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl)ethyl 4-ethoxybenzoate.
| Compound Name | 2-(5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl)ethyl 4-ethoxybenzoate |
|---|---|
| PubChem CID | 3525438 |
| Molecular Formula | C21H32NO3+ |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 2-(5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl)ethyl 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCCC2CCC[N+]3(C)CCCCC23)cc1 |
| InChI | InChI=1S/C21H32NO3/c1-3-24-19-11-9-18(10-12-19)21(23)25-16-13-17-7-6-15-22(2)14-5-4-8-20(17)22/h9-12,17,20H,3-8,13-16H2,1-2H3/q+1 |
| InChIKey | JKGLLRLAYPIYPO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|