C18H32NO4+ — CID 11872865
diethyl 2-[[(1S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl]propanedioate (PubChem CID 11872865) has the molecular formula C18H32NO4+ and a molecular weight of 326.46 g/mol. Its IUPAC name is diethyl 2-[[(1S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl]propanedioate.
| Compound Name | diethyl 2-[[(1S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 11872865 |
| Molecular Formula | C18H32NO4+ |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | diethyl 2-[[(1S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl]propanedioate |
| SMILES | CCOC(=O)C(C[C@@H]1CCC[N+]2(C)CCCC[C@H]12)C(=O)OCC |
| InChI | InChI=1S/C18H32NO4/c1-4-22-17(20)15(18(21)23-5-2)13-14-9-8-12-19(3)11-7-6-10-16(14)19/h14-16H,4-13H2,1-3H3/q+1/t14-,16+,19?/m0/s1 |
| InChIKey | NONZADLMFDYBRU-FSGMKPHLSA-N |
| XLogP | 2.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|