C12H24NO+ — CID 6955094
2-[(1S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]ethanol (PubChem CID 6955094) has the molecular formula C12H24NO+ and a molecular weight of 198.33 g/mol. Its IUPAC name is 2-[(1S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]ethanol.
| Compound Name | 2-[(1S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]ethanol |
|---|---|
| PubChem CID | 6955094 |
| Molecular Formula | C12H24NO+ |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.19 |
| IUPAC Name | 2-[(1S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]ethanol |
| SMILES | C[N+]12CCCC[C@@H]1[C@H](CCO)CCC2 |
| InChI | InChI=1S/C12H24NO/c1-13-8-3-2-6-12(13)11(7-10-14)5-4-9-13/h11-12,14H,2-10H2,1H3/q+1/t11-,12+,13?/m0/s1 |
| InChIKey | GCMCDBVXBVNWAL-LAGVYOHYSA-N |
| XLogP | 1.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|