C17H31N2O2+ — CID 129449109
[(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl piperidine-4-carboxylate (PubChem CID 129449109) has the molecular formula C17H31N2O2+ and a molecular weight of 295.45 g/mol. Its IUPAC name is [(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl piperidine-4-carboxylate.
| Compound Name | [(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl piperidine-4-carboxylate |
|---|---|
| PubChem CID | 129449109 |
| Molecular Formula | C17H31N2O2+ |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.24 |
| IUPAC Name | [(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl piperidine-4-carboxylate |
| SMILES | C[N@+]12CCCC[C@H]1[C@@H](COC(=O)C1CCNCC1)CCC2 |
| InChI | InChI=1S/C17H31N2O2/c1-19-11-3-2-6-16(19)15(5-4-12-19)13-21-17(20)14-7-9-18-10-8-14/h14-16,18H,2-13H2,1H3/q+1/t15-,16+,19-/m1/s1 |
| InChIKey | CUEHRXOORKFAMS-JTDSTZFVSA-N |
| XLogP | 1.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|