C22H35ClNO2+ — CID 98486063
[(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl (5S,7S)-3-chloroadamantane-1-carboxylate (PubChem CID 98486063) has the molecular formula C22H35ClNO2+ and a molecular weight of 380.98 g/mol. Its IUPAC name is [(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl (5S,7S)-3-chloroadamantane-1-carboxylate.
| Compound Name | [(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl (5S,7S)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98486063 |
| Molecular Formula | C22H35ClNO2+ |
| Molecular Weight | 380.98 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | [(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl (5S,7S)-3-chloroadamantane-1-carboxylate |
| SMILES | C[N+]12CCCC[C@@H]1[C@H](COC(=O)C13C[C@@H]4C[C@H](CC(Cl)(C4)C1)C3)CCC2 |
| InChI | InChI=1S/C22H35ClNO2/c1-24-7-3-2-6-19(24)18(5-4-8-24)14-26-20(25)21-10-16-9-17(11-21)13-22(23,12-16)15-21/h16-19H,2-15H2,1H3/q+1/t16-,17-,18-,19+,21?,22?,24?/m0/s1 |
| InChIKey | KBOAUZXZOYOMEX-UJAKOLNISA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.98 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|