C21H32INO4 — CID 172885219
2-[(1S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]ethyl 2,4-dimethoxybenzoate iodide (PubChem CID 172885219) has the molecular formula C21H32INO4 and a molecular weight of 489.39 g/mol. Its IUPAC name is 2-[(1S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]ethyl 2,4-dimethoxybenzoate iodide.
| Compound Name | 2-[(1S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]ethyl 2,4-dimethoxybenzoate iodide |
|---|---|
| PubChem CID | 172885219 |
| Molecular Formula | C21H32INO4 |
| Molecular Weight | 489.39 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 2-[(1S,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]ethyl 2,4-dimethoxybenzoate iodide |
| SMILES | COc1ccc(C(=O)OCC[C@@H]2CCC[N+]3(C)CCCC[C@H]23)c(OC)c1.[I-] |
| InChI | InChI=1S/C21H32NO4.HI/c1-22-12-5-4-8-19(22)16(7-6-13-22)11-14-26-21(23)18-10-9-17(24-2)15-20(18)25-3;/h9-10,15-16,19H,4-8,11-14H2,1-3H3;1H/q+1;/p-1/t16-,19+,22?;/m0./s1 |
| InChIKey | FBHCBUUYIQGBLQ-NYITZVBZSA-M |
| XLogP | 0.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.39 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|