C20H28INO2 — CID 44659456
[(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl (E)-3-phenylprop-2-enoate iodide (PubChem CID 44659456) has the molecular formula C20H28INO2 and a molecular weight of 441.35 g/mol. Its IUPAC name is [(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl (E)-3-phenylprop-2-enoate iodide.
| Compound Name | [(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl (E)-3-phenylprop-2-enoate iodide |
|---|---|
| PubChem CID | 44659456 |
| Molecular Formula | C20H28INO2 |
| Molecular Weight | 441.35 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | [(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl (E)-3-phenylprop-2-enoate iodide |
| SMILES | C[N+]12CCCC[C@@H]1[C@H](COC(=O)/C=C/c1ccccc1)CCC2.[I-] |
| InChI | InChI=1S/C20H28NO2.HI/c1-21-14-6-5-11-19(21)18(10-7-15-21)16-23-20(22)13-12-17-8-3-2-4-9-17;/h2-4,8-9,12-13,18-19H,5-7,10-11,14-16H2,1H3;1H/q+1;/p-1/b13-12+;/t18-,19+,21?;/m0./s1 |
| InChIKey | RQSJKPVNNULLOY-CSFJXTAPSA-M |
| XLogP | 0.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|