C23H20Cl2O4 — CID 7897041
[(1S,3R)-2,2-dichloro-3-[[(E)-3-phenylprop-2-enoyl]oxymethyl]cyclopropyl]methyl (E)-3-phenylprop-2-enoate (PubChem CID 7897041) has the molecular formula C23H20Cl2O4 and a molecular weight of 431.32 g/mol. Its IUPAC name is [(1S,3R)-2,2-dichloro-3-[[(E)-3-phenylprop-2-enoyl]oxymethyl]cyclopropyl]methyl (E)-3-phenylprop-2-enoate.
| Compound Name | [(1S,3R)-2,2-dichloro-3-[[(E)-3-phenylprop-2-enoyl]oxymethyl]cyclopropyl]methyl (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 7897041 |
| Molecular Formula | C23H20Cl2O4 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | [(1S,3R)-2,2-dichloro-3-[[(E)-3-phenylprop-2-enoyl]oxymethyl]cyclopropyl]methyl (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)OC[C@@H]1[C@H](COC(=O)/C=C/c2ccccc2)C1(Cl)Cl |
| InChI | InChI=1S/C23H20Cl2O4/c24-23(25)19(15-28-21(26)13-11-17-7-3-1-4-8-17)20(23)16-29-22(27)14-12-18-9-5-2-6-10-18/h1-14,19-20H,15-16H2/b13-11+,14-12+/t19-,20+ |
| InChIKey | OPEOMUGBUBKGGU-RSEWVQGVSA-N |
| XLogP | 4.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|