C15H18O3 — CID 73083639
oxan-2-ylmethyl 3-phenylprop-2-enoate (PubChem CID 73083639) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is oxan-2-ylmethyl 3-phenylprop-2-enoate.
| Compound Name | oxan-2-ylmethyl 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 73083639 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | oxan-2-ylmethyl 3-phenylprop-2-enoate |
| SMILES | O=C(C=Cc1ccccc1)OCC1CCCCO1 |
| InChI | InChI=1S/C15H18O3/c16-15(10-9-13-6-2-1-3-7-13)18-12-14-8-4-5-11-17-14/h1-3,6-7,9-10,14H,4-5,8,11-12H2 |
| InChIKey | PZTONKYAOYKHAP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|