C16H16ClF3O3 — CID 76856622
oxan-2-ylmethyl 3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 76856622) has the molecular formula C16H16ClF3O3 and a molecular weight of 348.75 g/mol. Its IUPAC name is oxan-2-ylmethyl 3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | oxan-2-ylmethyl 3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 76856622 |
| Molecular Formula | C16H16ClF3O3 |
| Molecular Weight | 348.75 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | oxan-2-ylmethyl 3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(Cl)c(C(F)(F)F)c1)OCC1CCCCO1 |
| InChI | InChI=1S/C16H16ClF3O3/c17-14-6-4-11(9-13(14)16(18,19)20)5-7-15(21)23-10-12-3-1-2-8-22-12/h4-7,9,12H,1-3,8,10H2 |
| InChIKey | HKMGOGCSDBPDQT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.75 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|